ChemNet > CAS > 499771-12-9 1-[3-(2,6-dichlorophenyl)isoxazol-5-yl]ethan-1-one
499771-12-9 1-[3-(2,6-dichlorophenyl)isoxazol-5-yl]ethan-1-one
| Nama produk |
1-[3-(2,6-dichlorophenyl)isoxazol-5-yl]ethan-1-one |
| Sinonim |
1-[3-(2,6-dichlorophenyl)isoxazol-5-yl]ethanone |
| MF |
C11H7Cl2NO2 |
| Berat Molekul |
256.0848 |
| InChI |
InChI=1/C11H7Cl2NO2/c1-6(15)10-5-9(14-16-10)11-7(12)3-2-4-8(11)13/h2-5H,1H3 |
| CAS NO |
499771-12-9 |
| Struktur Molekul |
![499771-12-9 1-[3-(2,6-dichlorophenyl)isoxazol-5-yl]ethan-1-one](https://images-a.chemnet.com/suppliers/chembase/163/16328.gif)
|
| Kepadatan |
1.375g/cm3 |
| Titik lebur |
116℃ |
| Titik didih |
389.3°C at 760 mmHg |
| Indeks bias |
1.569 |
| Titik nyala |
189.2°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
